C20H28N2 — CID 123192785
4,5-diethyl-3,4-dimethyl-5-prop-1-en-2-yl-3aH-imidazo[1,2-a]quinoline (PubChem CID 123192785) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 4,5-diethyl-3,4-dimethyl-5-prop-1-en-2-yl-3aH-imidazo[1,2-a]quinoline.
| Compound Name | 4,5-diethyl-3,4-dimethyl-5-prop-1-en-2-yl-3aH-imidazo[1,2-a]quinoline |
|---|---|
| PubChem CID | 123192785 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 4,5-diethyl-3,4-dimethyl-5-prop-1-en-2-yl-3aH-imidazo[1,2-a]quinoline |
| SMILES | C=C(C)C1(CC)c2ccccc2N2C=CN(C)C2C1(C)CC |
| InChI | InChI=1S/C20H28N2/c1-7-19(5)18-21(6)13-14-22(18)17-12-10-9-11-16(17)20(19,8-2)15(3)4/h9-14,18H,3,7-8H2,1-2,4-6H3 |
| InChIKey | NEELQVMRTYRWDD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|