C33H28FN6O4+ — CID 123193388
N-[(4-fluorophenyl)methyl]-4-[2-[2-methoxy-4-(6-oxa-3-azoniatricyclo[2.2.1.01,3]heptane-3-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide (PubChem CID 123193388) has the molecular formula C33H28FN6O4+ and a molecular weight of 591.62 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[2-[2-methoxy-4-(6-oxa-3-azoniatricyclo[2.2.1.01,3]heptane-3-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[2-[2-methoxy-4-(6-oxa-3-azoniatricyclo[2.2.1.01,3]heptane-3-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 123193388 |
| Molecular Formula | C33H28FN6O4+ |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[2-[2-methoxy-4-(6-oxa-3-azoniatricyclo[2.2.1.01,3]heptane-3-carbonyl)anilino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide |
| SMILES | COc1cc(C(=O)[N+]23CC24CC3CO4)ccc1Nc1nc2ccc(-c3ccc(C(=O)NCc4ccc(F)cc4)cc3)cn2n1 |
| InChI | InChI=1S/C33H27FN6O4/c1-43-28-14-23(31(42)40-19-33(40)15-26(40)18-44-33)8-12-27(28)36-32-37-29-13-9-24(17-39(29)38-32)21-4-6-22(7-5-21)30(41)35-16-20-2-10-25(34)11-3-20/h2-14,17,26H,15-16,18-19H2,1H3,(H-,35,36,38,41,42)/p+1 |
| InChIKey | VGOCNQJELPTKOG-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|