C22H19ClFNO5S — CID 123193467
N-[5-[(2-chloro-6-fluorophenyl)methoxy]-2-formylphenyl]-3-methoxy-4-methylbenzenesulfonamide (PubChem CID 123193467) has the molecular formula C22H19ClFNO5S and a molecular weight of 463.91 g/mol. Its IUPAC name is N-[5-[(2-chloro-6-fluorophenyl)methoxy]-2-formylphenyl]-3-methoxy-4-methylbenzenesulfonamide.
| Compound Name | N-[5-[(2-chloro-6-fluorophenyl)methoxy]-2-formylphenyl]-3-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 123193467 |
| Molecular Formula | C22H19ClFNO5S |
| Molecular Weight | 463.91 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | N-[5-[(2-chloro-6-fluorophenyl)methoxy]-2-formylphenyl]-3-methoxy-4-methylbenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2cc(OCc3c(F)cccc3Cl)ccc2C=O)ccc1C |
| InChI | InChI=1S/C22H19ClFNO5S/c1-14-6-9-17(11-22(14)29-2)31(27,28)25-21-10-16(8-7-15(21)12-26)30-13-18-19(23)4-3-5-20(18)24/h3-12,25H,13H2,1-2H3 |
| InChIKey | IQPWACWFDRHVCS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.91 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|