About 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine
2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine (PubChem CID 123194306) has the molecular formula C21H38FN
and a molecular weight of 323.54 g/mol. Its IUPAC name is 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine |
| PubChem CID | 123194306 |
| Molecular Formula | C21H38FN |
| Molecular Weight | 323.54 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine |
| SMILES | CCCC(C)CC1C(=C(CCCF)C(C)C=C(C)CC)C1NC |
| InChI | InChI=1S/C21H38FN/c1-7-10-16(4)14-19-20(21(19)23-6)18(11-9-12-22)17(5)13-15(3)8-2/h13,16-17,19,21,23H,7-12,14H2,1-6H3 |
| InChIKey | NIIICSBXLAIBMM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine?
The IUPAC name of 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine (CID 123194306) is 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine.
What is the SMILES notation for 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine?
The canonical SMILES for 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine is CCCC(C)CC1C(=C(CCCF)C(C)C=C(C)CC)C1NC.
What is the InChIKey of 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine?
The InChIKey is NIIICSBXLAIBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38FN/c1-7-10-16(4)14-19-20(21(19)23-6)18(11-9-12-22)17(5)13-15(3)8-2/h13,16-17,19,21,23H,7-12,14H2,1-6H3.
What are the key properties of 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine?
2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine has a molecular weight of 323.54 g/mol, XLogP of 6.07, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluoro-5,7-dimethylnon-6-en-4-ylidene)-N-methyl-3-(2-methylpentyl)cyclopropan-1-amine is sourced from PubChem (CID 123194306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).