About 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine
9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine (PubChem CID 123194377) has the molecular formula C25H21N3O2
and a molecular weight of 395.46 g/mol. Its IUPAC name is 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine |
| PubChem CID | 123194377 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine |
| SMILES | COc1ccc(COc2cccc3cc4c(-c5ccccc5)nc(N)[nH]c-4c23)cc1 |
| InChI | InChI=1S/C25H21N3O2/c1-29-19-12-10-16(11-13-19)15-30-21-9-5-8-18-14-20-23(17-6-3-2-4-7-17)27-25(26)28-24(20)22(18)21/h2-14H,15H2,1H3,(H3,26,27,28) |
| InChIKey | OQJHKOYBXIUIKI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine?
The IUPAC name of 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine (CID 123194377) is 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine.
What is the SMILES notation for 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine?
The canonical SMILES for 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine is COc1ccc(COc2cccc3cc4c(-c5ccccc5)nc(N)[nH]c-4c23)cc1.
What is the InChIKey of 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine?
The InChIKey is OQJHKOYBXIUIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O2/c1-29-19-12-10-16(11-13-19)15-30-21-9-5-8-18-14-20-23(17-6-3-2-4-7-17)27-25(26)28-24(20)22(18)21/h2-14H,15H2,1H3,(H3,26,27,28).
What are the key properties of 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine?
9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine has a molecular weight of 395.46 g/mol, XLogP of 5.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(4-methoxyphenyl)methoxy]-4-phenyl-1H-indeno[1,2-d]pyrimidin-2-amine is sourced from PubChem (CID 123194377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).