About 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide
2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 123195260) has the molecular formula C6H10F3N3O2
and a molecular weight of 213.16 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide.
Molecular Properties
| Compound Name | 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide |
| PubChem CID | 123195260 |
| Molecular Formula | C6H10F3N3O2 |
| Molecular Weight | 213.16 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(NC(N)=O)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H10F3N3O2/c1-3(12-5(10)14)4(13)11-2-6(7,8)9/h3H,2H2,1H3,(H,11,13)(H3,10,12,14) |
| InChIKey | JNANCBYKCOYIDP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide?
The IUPAC name of 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide (CID 123195260) is 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide.
What is the SMILES notation for 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide?
The canonical SMILES for 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide is CC(NC(N)=O)C(=O)NCC(F)(F)F.
What is the InChIKey of 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide?
The InChIKey is JNANCBYKCOYIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F3N3O2/c1-3(12-5(10)14)4(13)11-2-6(7,8)9/h3H,2H2,1H3,(H,11,13)(H3,10,12,14).
What are the key properties of 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide?
2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide has a molecular weight of 213.16 g/mol, XLogP of -0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)-N-(2,2,2-trifluoroethyl)propanamide is sourced from PubChem (CID 123195260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).