About 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one
2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one (PubChem CID 123195273) has the molecular formula C23H23FN2O2
and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one.
Molecular Properties
| Compound Name | 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one |
| PubChem CID | 123195273 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one |
| SMILES | C=CC(=C)c1cccc(-n2ncc3cc(C(C)(C)C)cc(F)c3c2=O)c1CO |
| InChI | InChI=1S/C23H23FN2O2/c1-6-14(2)17-8-7-9-20(18(17)13-27)26-22(28)21-15(12-25-26)10-16(11-19(21)24)23(3,4)5/h6-12,27H,1-2,13H2,3-5H3 |
| InChIKey | BLXQBMPPCJOLED-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one?
The IUPAC name of 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one (CID 123195273) is 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one.
What is the SMILES notation for 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one?
The canonical SMILES for 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one is C=CC(=C)c1cccc(-n2ncc3cc(C(C)(C)C)cc(F)c3c2=O)c1CO.
What is the InChIKey of 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one?
The InChIKey is BLXQBMPPCJOLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN2O2/c1-6-14(2)17-8-7-9-20(18(17)13-27)26-22(28)21-15(12-25-26)10-16(11-19(21)24)23(3,4)5/h6-12,27H,1-2,13H2,3-5H3.
What are the key properties of 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one?
2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one has a molecular weight of 378.45 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-buta-1,3-dien-2-yl-2-(hydroxymethyl)phenyl]-6-tert-butyl-8-fluorophthalazin-1-one is sourced from PubChem (CID 123195273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).