C20H38N2O — CID 123195484
2,2,6,6-tetramethyl-8-(3-methyl-3-propyloxiran-2-yl)-1,7-diazacyclododec-3-ene (PubChem CID 123195484) has the molecular formula C20H38N2O and a molecular weight of 322.54 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-8-(3-methyl-3-propyloxiran-2-yl)-1,7-diazacyclododec-3-ene.
| Compound Name | 2,2,6,6-tetramethyl-8-(3-methyl-3-propyloxiran-2-yl)-1,7-diazacyclododec-3-ene |
|---|---|
| PubChem CID | 123195484 |
| Molecular Formula | C20H38N2O |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.30 |
| IUPAC Name | 2,2,6,6-tetramethyl-8-(3-methyl-3-propyloxiran-2-yl)-1,7-diazacyclododec-3-ene |
| SMILES | CCCC1(C)OC1C1CCCCNC(C)(C)C=CCC(C)(C)N1 |
| InChI | InChI=1S/C20H38N2O/c1-7-12-20(6)17(23-20)16-11-8-9-15-21-18(2,3)13-10-14-19(4,5)22-16/h10,13,16-17,21-22H,7-9,11-12,14-15H2,1-6H3 |
| InChIKey | JAQOHGNFNSFJPK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 36.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|