C21H18B11F2N4O — CID 123195525
CID 123195525 (PubChem CID 123195525) has the molecular formula C21H18B11F2N4O and a molecular weight of 499.33 g/mol.
| Compound Name | CID 123195525 |
|---|---|
| PubChem CID | 123195525 |
| Molecular Formula | C21H18B11F2N4O |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2noc(-c3ccc(N4CCC(F)CC4)c(C#N)c3)n2)ccc1F.[B][B]B([B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C21H18F2N4O.B11/c1-13-10-14(2-4-18(13)23)20-25-21(28-26-20)15-3-5-19(16(11-15)12-24)27-8-6-17(22)7-9-27;1-7-10(6)11(8(2)3)9(4)5/h2-5,10-11,17H,6-9H2,1H3; |
| InChIKey | KOLNFVVAPJMXMH-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|