C27H39FN6O2 — CID 123195589
4-N-[5-fluoro-4-[6-[[4-(methyliminomethyl)oxan-4-yl]methylamino]-2-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine (PubChem CID 123195589) has the molecular formula C27H39FN6O2 and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-N-[5-fluoro-4-[6-[[4-(methyliminomethyl)oxan-4-yl]methylamino]-2-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[5-fluoro-4-[6-[[4-(methyliminomethyl)oxan-4-yl]methylamino]-2-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 123195589 |
| Molecular Formula | C27H39FN6O2 |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 4-N-[5-fluoro-4-[6-[[4-(methyliminomethyl)oxan-4-yl]methylamino]-2-pyridinyl]-2-pyridinyl]-1-N-(2-methoxyethyl)cyclohexane-1,4-diamine |
| SMILES | C/N=C/C1(CNc2cccc(-c3cc(NC4CCC(NCCOC)CC4)ncc3F)n2)CCOCC1 |
| InChI | InChI=1S/C27H39FN6O2/c1-29-18-27(10-13-36-14-11-27)19-32-25-5-3-4-24(34-25)22-16-26(31-17-23(22)28)33-21-8-6-20(7-9-21)30-12-15-35-2/h3-5,16-18,20-21,30H,6-15,19H2,1-2H3,(H,31,33)(H,32,34)/b29-18+ |
| InChIKey | XFBMLUIANTWDIT-RDRPBHBLSA-N |
| XLogP | 4.15 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|