About 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium
1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium (PubChem CID 123195700) has the molecular formula C16H26N2+2
and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium.
Molecular Properties
| Compound Name | 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium |
| PubChem CID | 123195700 |
| Molecular Formula | C16H26N2+2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium |
| SMILES | C=[N+]1CC[N+](CC)=C(C=CC)C1=CC=C(C)CC |
| InChI | InChI=1S/C16H26N2/c1-6-9-16-15(11-10-14(4)7-2)17(5)12-13-18(16)8-3/h6,9-11H,5,7-8,12-13H2,1-4H3/q+2 |
| InChIKey | OTPPBESHFAFWLA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium?
The IUPAC name of 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium (CID 123195700) is 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium.
What is the SMILES notation for 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium?
The canonical SMILES for 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium is C=[N+]1CC[N+](CC)=C(C=CC)C1=CC=C(C)CC.
What is the InChIKey of 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium?
The InChIKey is OTPPBESHFAFWLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-6-9-16-15(11-10-14(4)7-2)17(5)12-13-18(16)8-3/h6,9-11H,5,7-8,12-13H2,1-4H3/q+2.
What are the key properties of 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium?
1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium has a molecular weight of 246.40 g/mol, XLogP of 3.00, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methylidene-5-(3-methylpent-2-enylidene)-6-prop-1-enyl-2,3-dihydropyrazine-1,4-diium is sourced from PubChem (CID 123195700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).