C30H33N7O2 — CID 123196159
3-[2-amino-4-methyl-6-[1-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-2-[(cyclopropylamino)methyl]prop-2-enal (PubChem CID 123196159) has the molecular formula C30H33N7O2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 3-[2-amino-4-methyl-6-[1-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-2-[(cyclopropylamino)methyl]prop-2-enal.
| Compound Name | 3-[2-amino-4-methyl-6-[1-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-2-[(cyclopropylamino)methyl]prop-2-enal |
|---|---|
| PubChem CID | 123196159 |
| Molecular Formula | C30H33N7O2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 3-[2-amino-4-methyl-6-[1-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-2-[(cyclopropylamino)methyl]prop-2-enal |
| SMILES | CCC(Nc1nc(N)nc(C)c1C=C(C=O)CNC1CC1)c1nc2cccc(C)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H33N7O2/c1-4-24(34-27-23(19(3)33-30(31)36-27)15-20(17-38)16-32-21-13-14-21)28-35-25-12-8-9-18(2)26(25)29(39)37(28)22-10-6-5-7-11-22/h5-12,15,17,21,24,32H,4,13-14,16H2,1-3H3,(H3,31,33,34,36) |
| InChIKey | GNMJTYQDLISMCZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|