C22H16BrN5O2S — CID 123197445
1-[9-bromo-3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]pentane-1,4-dione (PubChem CID 123197445) has the molecular formula C22H16BrN5O2S and a molecular weight of 494.37 g/mol. Its IUPAC name is 1-[9-bromo-3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]pentane-1,4-dione.
| Compound Name | 1-[9-bromo-3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]pentane-1,4-dione |
|---|---|
| PubChem CID | 123197445 |
| Molecular Formula | C22H16BrN5O2S |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 1-[9-bromo-3-[(2-isocyanophenyl)methylsulfanyl]-[1,2,4]triazino[5,6-b]indol-5-yl]pentane-1,4-dione |
| SMILES | [C-]#[N+]c1ccccc1CSc1nnc2c3c(Br)cccc3n(C(=O)CCC(C)=O)c2n1 |
| InChI | InChI=1S/C22H16BrN5O2S/c1-13(29)10-11-18(30)28-17-9-5-7-15(23)19(17)20-21(28)25-22(27-26-20)31-12-14-6-3-4-8-16(14)24-2/h3-9H,10-12H2,1H3 |
| InChIKey | OBIKNYKHBIOEEW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 82.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|