About 4-fluorocyclohepta-2,6-dien-1-imine
4-fluorocyclohepta-2,6-dien-1-imine (PubChem CID 123197524) has the molecular formula C7H8FN
and a molecular weight of 125.15 g/mol. Its IUPAC name is 4-fluorocyclohepta-2,6-dien-1-imine.
Molecular Properties
| Compound Name | 4-fluorocyclohepta-2,6-dien-1-imine |
| PubChem CID | 123197524 |
| Molecular Formula | C7H8FN |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 4-fluorocyclohepta-2,6-dien-1-imine |
| SMILES | [H]/N=C1\C=CCC(F)C=C1 |
| InChI | InChI=1S/C7H8FN/c8-6-2-1-3-7(9)5-4-6/h1,3-6,9H,2H2/b9-7+ |
| InChIKey | PNNSGPGRRCRTIZ-VQHVLOKHSA-N |
| XLogP | 1.86 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorocyclohepta-2,6-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorocyclohepta-2,6-dien-1-imine?
The IUPAC name of 4-fluorocyclohepta-2,6-dien-1-imine (CID 123197524) is 4-fluorocyclohepta-2,6-dien-1-imine.
What is the SMILES notation for 4-fluorocyclohepta-2,6-dien-1-imine?
The canonical SMILES for 4-fluorocyclohepta-2,6-dien-1-imine is [H]/N=C1\C=CCC(F)C=C1.
What is the InChIKey of 4-fluorocyclohepta-2,6-dien-1-imine?
The InChIKey is PNNSGPGRRCRTIZ-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H8FN/c8-6-2-1-3-7(9)5-4-6/h1,3-6,9H,2H2/b9-7+.
What are the key properties of 4-fluorocyclohepta-2,6-dien-1-imine?
4-fluorocyclohepta-2,6-dien-1-imine has a molecular weight of 125.15 g/mol, XLogP of 1.86, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorocyclohepta-2,6-dien-1-imine is sourced from PubChem (CID 123197524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).