C11H15NO3 — CID 123197567
4-[3-(hydroxymethyl)phenoxy]butanamide (PubChem CID 123197567) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-[3-(hydroxymethyl)phenoxy]butanamide.
| Compound Name | 4-[3-(hydroxymethyl)phenoxy]butanamide |
|---|---|
| PubChem CID | 123197567 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-[3-(hydroxymethyl)phenoxy]butanamide |
| SMILES | NC(=O)CCCOc1cccc(CO)c1 |
| InChI | InChI=1S/C11H15NO3/c12-11(14)5-2-6-15-10-4-1-3-9(7-10)8-13/h1,3-4,7,13H,2,5-6,8H2,(H2,12,14) |
| InChIKey | AQDAHMSFSZENQT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|