C63H42O3S — CID 123197571
10,10-dioxo-2-spiro[1,2,4b,5-tetrahydrofluorene-9,9'-fluorene]-2'-yl-7-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylthioxanthen-9-one (PubChem CID 123197571) has the molecular formula C63H42O3S and a molecular weight of 879.09 g/mol. Its IUPAC name is 10,10-dioxo-2-spiro[1,2,4b,5-tetrahydrofluorene-9,9'-fluorene]-2'-yl-7-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylthioxanthen-9-one.
| Compound Name | 10,10-dioxo-2-spiro[1,2,4b,5-tetrahydrofluorene-9,9'-fluorene]-2'-yl-7-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylthioxanthen-9-one |
|---|---|
| PubChem CID | 123197571 |
| Molecular Formula | C63H42O3S |
| Molecular Weight | 879.09 g/mol |
| Exact Mass | 878.29 |
| IUPAC Name | 10,10-dioxo-2-spiro[1,2,4b,5-tetrahydrofluorene-9,9'-fluorene]-2'-yl-7-spiro[1,2-dihydrofluorene-9,9'-fluorene]-2'-ylthioxanthen-9-one |
| SMILES | O=C1c2cc(-c3ccc4c(c3)C3(C5=CC=CCC5C5=C3CCC=C5)c3ccccc3-4)ccc2S(=O)(=O)c2ccc(-c3ccc4c(c3)C3(C5=C(C=CCC5)c5ccccc53)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C63H42O3S/c64-61-49-33-37(39-25-29-47-45-17-5-11-23-55(45)62(57(47)35-39)51-19-7-1-13-41(51)42-14-2-8-20-52(42)62)27-31-59(49)67(65,66)60-32-28-38(34-50(60)61)40-26-30-48-46-18-6-12-24-56(46)63(58(48)36-40)53-21-9-3-15-43(53)44-16-4-10-22-54(44)63/h1-7,9,11-14,16-19,21,23-36,43H,8,10,15,20,22H2 |
| InChIKey | HTWAAWVMLFLASO-UHFFFAOYSA-N |
| XLogP | 14.26 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.09 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |