C14H27N — CID 123197704
(Z)-2,2,3,8,8-pentamethylnon-5-en-4-imine (PubChem CID 123197704) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is (Z)-2,2,3,8,8-pentamethylnon-5-en-4-imine.
| Compound Name | (Z)-2,2,3,8,8-pentamethylnon-5-en-4-imine |
|---|---|
| PubChem CID | 123197704 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | (Z)-2,2,3,8,8-pentamethylnon-5-en-4-imine |
| SMILES | [H]/N=C(\C=C/CC(C)(C)C)C(C)C(C)(C)C |
| InChI | InChI=1S/C14H27N/c1-11(14(5,6)7)12(15)9-8-10-13(2,3)4/h8-9,11,15H,10H2,1-7H3/b9-8-,15-12+ |
| InChIKey | JQQICZMLFCEBAT-LNJBCKSWSA-N |
| XLogP | 4.68 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|