C14H16O2 — CID 123198267
5,12-dioxaheptacyclo[7.6.1.02,8.03,7.04,6.010,15.011,13]hexadecane (PubChem CID 123198267) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 5,12-dioxaheptacyclo[7.6.1.02,8.03,7.04,6.010,15.011,13]hexadecane.
| Compound Name | 5,12-dioxaheptacyclo[7.6.1.02,8.03,7.04,6.010,15.011,13]hexadecane |
|---|---|
| PubChem CID | 123198267 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 5,12-dioxaheptacyclo[7.6.1.02,8.03,7.04,6.010,15.011,13]hexadecane |
| SMILES | C1C2OC2C2C1C1CC2C2C1C1C3OC3C21 |
| InChI | InChI=1S/C14H16O2/c1-3-4-2-6-12(15-6)7(4)5(1)9-8(3)10-11(9)14-13(10)16-14/h3-14H,1-2H2 |
| InChIKey | FIJCQPGFTZVSOZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|