C30H38N2O5 — CID 123198293
6-[14-(dimethylamino)-9,12,13-trihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-en-5-yl]-2H-isoquinolin-3-one (PubChem CID 123198293) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is 6-[14-(dimethylamino)-9,12,13-trihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-en-5-yl]-2H-isoquinolin-3-one.
| Compound Name | 6-[14-(dimethylamino)-9,12,13-trihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-en-5-yl]-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 123198293 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 6-[14-(dimethylamino)-9,12,13-trihydroxy-6-methyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-4-en-5-yl]-2H-isoquinolin-3-one |
| SMILES | CN(C)C1CC23CCC4(O2)C2CC=C(c5ccc6c[nH]c(=O)cc6c5)C2(C)CCC4(O)CC3C(O)C1O |
| InChI | InChI=1S/C30H38N2O5/c1-27-8-10-29(36)14-21-25(34)26(35)22(32(2)3)15-28(21)9-11-30(29,37-28)23(27)7-6-20(27)17-4-5-18-16-31-24(33)13-19(18)12-17/h4-6,12-13,16,21-23,25-26,34-36H,7-11,14-15H2,1-3H3,(H,31,33) |
| InChIKey | IGOHAUJHVYHWHP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |