C14H26N2Si — CID 123198597
1-N,1-N,1-N',1-N'-tetramethyl-4-phenylsilylbutane-1,1-diamine (PubChem CID 123198597) has the molecular formula C14H26N2Si and a molecular weight of 250.46 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetramethyl-4-phenylsilylbutane-1,1-diamine.
| Compound Name | 1-N,1-N,1-N',1-N'-tetramethyl-4-phenylsilylbutane-1,1-diamine |
|---|---|
| PubChem CID | 123198597 |
| Molecular Formula | C14H26N2Si |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetramethyl-4-phenylsilylbutane-1,1-diamine |
| SMILES | CN(C)C(CCC[SiH2]c1ccccc1)N(C)C |
| InChI | InChI=1S/C14H26N2Si/c1-15(2)14(16(3)4)11-8-12-17-13-9-6-5-7-10-13/h5-7,9-10,14H,8,11-12,17H2,1-4H3 |
| InChIKey | NVDCDPPPKOASJT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|