C12H26N2 — CID 123198751
N',N'-dimethyl-N-(2-methyl-4-methylideneheptyl)methanediamine (PubChem CID 123198751) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-(2-methyl-4-methylideneheptyl)methanediamine.
| Compound Name | N',N'-dimethyl-N-(2-methyl-4-methylideneheptyl)methanediamine |
|---|---|
| PubChem CID | 123198751 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N',N'-dimethyl-N-(2-methyl-4-methylideneheptyl)methanediamine |
| SMILES | C=C(CCC)CC(C)CNCN(C)C |
| InChI | InChI=1S/C12H26N2/c1-6-7-11(2)8-12(3)9-13-10-14(4)5/h12-13H,2,6-10H2,1,3-5H3 |
| InChIKey | FBRWDRVESKOXNK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|