About [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide
[2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide (PubChem CID 123199921) has the molecular formula C9H10FN3OS
and a molecular weight of 227.26 g/mol. Its IUPAC name is [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide.
Molecular Properties
| Compound Name | [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide |
| PubChem CID | 123199921 |
| Molecular Formula | C9H10FN3OS |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide |
| SMILES | CS(=O)(=CCc1ccc(F)nc1)NC#N |
| InChI | InChI=1S/C9H10FN3OS/c1-15(14,13-7-11)5-4-8-2-3-9(10)12-6-8/h2-3,5-6H,4H2,1H3,(H,13,14) |
| InChIKey | VWZYWINEDQYTRY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide?
The IUPAC name of [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide (CID 123199921) is [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide.
What is the SMILES notation for [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide?
The canonical SMILES for [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide is CS(=O)(=CCc1ccc(F)nc1)NC#N.
What is the InChIKey of [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide?
The InChIKey is VWZYWINEDQYTRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN3OS/c1-15(14,13-7-11)5-4-8-2-3-9(10)12-6-8/h2-3,5-6H,4H2,1H3,(H,13,14).
What are the key properties of [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide?
[2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide has a molecular weight of 227.26 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-fluoro-3-pyridinyl)ethylidene-methyl-oxo-λ6-sulfanyl]cyanamide is sourced from PubChem (CID 123199921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).