About 2-(1,1-dimethoxy-2-methylbutyl)silinane
2-(1,1-dimethoxy-2-methylbutyl)silinane (PubChem CID 123199922) has the molecular formula C12H26O2Si
and a molecular weight of 230.42 g/mol. Its IUPAC name is 2-(1,1-dimethoxy-2-methylbutyl)silinane.
Molecular Properties
| Compound Name | 2-(1,1-dimethoxy-2-methylbutyl)silinane |
| PubChem CID | 123199922 |
| Molecular Formula | C12H26O2Si |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-(1,1-dimethoxy-2-methylbutyl)silinane |
| SMILES | CCC(C)C(OC)(OC)C1CCCC[SiH2]1 |
| InChI | InChI=1S/C12H26O2Si/c1-5-10(2)12(13-3,14-4)11-8-6-7-9-15-11/h10-11H,5-9,15H2,1-4H3 |
| InChIKey | VVIDYOMRNIZERS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dimethoxy-2-methylbutyl)silinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dimethoxy-2-methylbutyl)silinane?
The IUPAC name of 2-(1,1-dimethoxy-2-methylbutyl)silinane (CID 123199922) is 2-(1,1-dimethoxy-2-methylbutyl)silinane.
What is the SMILES notation for 2-(1,1-dimethoxy-2-methylbutyl)silinane?
The canonical SMILES for 2-(1,1-dimethoxy-2-methylbutyl)silinane is CCC(C)C(OC)(OC)C1CCCC[SiH2]1.
What is the InChIKey of 2-(1,1-dimethoxy-2-methylbutyl)silinane?
The InChIKey is VVIDYOMRNIZERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2Si/c1-5-10(2)12(13-3,14-4)11-8-6-7-9-15-11/h10-11H,5-9,15H2,1-4H3.
What are the key properties of 2-(1,1-dimethoxy-2-methylbutyl)silinane?
2-(1,1-dimethoxy-2-methylbutyl)silinane has a molecular weight of 230.42 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dimethoxy-2-methylbutyl)silinane is sourced from PubChem (CID 123199922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).