About [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane
[2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane (PubChem CID 123199936) has the molecular formula C14H19F3OSi
and a molecular weight of 288.38 g/mol. Its IUPAC name is [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane.
Molecular Properties
| Compound Name | [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane |
| PubChem CID | 123199936 |
| Molecular Formula | C14H19F3OSi |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane |
| SMILES | FC(F)(F)C(CC1([SiH3])CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C14H19F3OSi/c15-14(16,17)12(11-6-2-1-3-7-11)10-13(19)8-4-5-9-18-13/h1-3,6-7,12H,4-5,8-10H2,19H3 |
| InChIKey | ISJWRNAHULMVSU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane?
The IUPAC name of [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane (CID 123199936) is [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane.
What is the SMILES notation for [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane?
The canonical SMILES for [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane is FC(F)(F)C(CC1([SiH3])CCCCO1)c1ccccc1.
What is the InChIKey of [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane?
The InChIKey is ISJWRNAHULMVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3OSi/c15-14(16,17)12(11-6-2-1-3-7-11)10-13(19)8-4-5-9-18-13/h1-3,6-7,12H,4-5,8-10H2,19H3.
What are the key properties of [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane?
[2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane has a molecular weight of 288.38 g/mol, XLogP of 2.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3,3-trifluoro-2-phenylpropyl)oxan-2-yl]silane is sourced from PubChem (CID 123199936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).