C9H10ClNO3S — CID 123199983
4-(amino-ethylidene-oxo-λ6-sulfanyl)-2-chlorobenzoic acid (PubChem CID 123199983) has the molecular formula C9H10ClNO3S and a molecular weight of 247.70 g/mol. Its IUPAC name is 4-(amino-ethylidene-oxo-λ6-sulfanyl)-2-chlorobenzoic acid.
| Compound Name | 4-(amino-ethylidene-oxo-λ6-sulfanyl)-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 123199983 |
| Molecular Formula | C9H10ClNO3S |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.01 |
| IUPAC Name | 4-(amino-ethylidene-oxo-λ6-sulfanyl)-2-chlorobenzoic acid |
| SMILES | CC=S(N)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClNO3S/c1-2-15(11,14)6-3-4-7(9(12)13)8(10)5-6/h2-5H,1H3,(H2,11,14)(H,12,13) |
| InChIKey | PTZIRKMABXLVCT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|