About 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine
5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine (PubChem CID 123200494) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine.
Molecular Properties
| Compound Name | 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine |
| PubChem CID | 123200494 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine |
| SMILES | [H]/N=C(\C)CC/C(CC)=N/C=C\C=N\C |
| InChI | InChI=1S/C11H19N3/c1-4-11(7-6-10(2)12)14-9-5-8-13-3/h5,8-9,12H,4,6-7H2,1-3H3/b9-5-,12-10+,13-8+,14-11+ |
| InChIKey | IQUZELZAFJFBER-UTGAGJMMSA-N |
| XLogP | 2.87 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine?
The IUPAC name of 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine (CID 123200494) is 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine.
What is the SMILES notation for 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine?
The canonical SMILES for 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine is [H]/N=C(\C)CC/C(CC)=N/C=C\C=N\C.
What is the InChIKey of 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine?
The InChIKey is IQUZELZAFJFBER-UTGAGJMMSA-N. The full InChI is InChI=1S/C11H19N3/c1-4-11(7-6-10(2)12)14-9-5-8-13-3/h5,8-9,12H,4,6-7H2,1-3H3/b9-5-,12-10+,13-8+,14-11+.
What are the key properties of 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine?
5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine has a molecular weight of 193.29 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[(Z)-3-methyliminoprop-1-enyl]heptane-2,5-diimine is sourced from PubChem (CID 123200494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).