C21H34O3 — CID 123200545
7-(3-hydroxyoctyl)-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene-1,8-diol (PubChem CID 123200545) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 7-(3-hydroxyoctyl)-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene-1,8-diol.
| Compound Name | 7-(3-hydroxyoctyl)-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene-1,8-diol |
|---|---|
| PubChem CID | 123200545 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 7-(3-hydroxyoctyl)-6,7,8,9,10,11-hexahydro-5H-benzo[9]annulene-1,8-diol |
| SMILES | CCCCCC(O)CCC1CCc2cccc(O)c2CCCC1O |
| InChI | InChI=1S/C21H34O3/c1-2-3-4-8-18(22)15-14-17-13-12-16-7-5-11-21(24)19(16)9-6-10-20(17)23/h5,7,11,17-18,20,22-24H,2-4,6,8-10,12-15H2,1H3 |
| InChIKey | IFVOUJSZYVKLCD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|