C54H77N7O2 — CID 123200556
5-(dimethylamino)-3-methoxy-1,4-bis[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-2-ol (PubChem CID 123200556) has the molecular formula C54H77N7O2 and a molecular weight of 856.26 g/mol. Its IUPAC name is 5-(dimethylamino)-3-methoxy-1,4-bis[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-2-ol.
| Compound Name | 5-(dimethylamino)-3-methoxy-1,4-bis[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-2-ol |
|---|---|
| PubChem CID | 123200556 |
| Molecular Formula | C54H77N7O2 |
| Molecular Weight | 856.26 g/mol |
| Exact Mass | 855.61 |
| IUPAC Name | 5-(dimethylamino)-3-methoxy-1,4-bis[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]pentan-2-ol |
| SMILES | COC(C(O)CN1CCN(c2cccc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)n2)CC1)C(CN(C)C)N1CCN(c2cccc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)n2)CC1 |
| InChI | InChI=1S/C54H77N7O2/c1-51(2)22-24-53(5,6)42-34-38(18-20-40(42)51)44-14-12-16-48(55-44)60-28-26-58(27-29-60)37-47(62)50(63-11)46(36-57(9)10)59-30-32-61(33-31-59)49-17-13-15-45(56-49)39-19-21-41-43(35-39)54(7,8)25-23-52(41,3)4/h12-21,34-35,46-47,50,62H,22-33,36-37H2,1-11H3 |
| InChIKey | QRESTAHCDMEIAH-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.26 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |