C20H29BN2O2 — CID 123200610
1-[[4-(4-butyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylimidazole (PubChem CID 123200610) has the molecular formula C20H29BN2O2 and a molecular weight of 340.28 g/mol. Its IUPAC name is 1-[[4-(4-butyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylimidazole.
| Compound Name | 1-[[4-(4-butyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylimidazole |
|---|---|
| PubChem CID | 123200610 |
| Molecular Formula | C20H29BN2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 1-[[4-(4-butyl-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-methylimidazole |
| SMILES | CCCCC1(C)OB(c2ccc(Cn3ccnc3C)cc2)OC1(C)C |
| InChI | InChI=1S/C20H29BN2O2/c1-6-7-12-20(5)19(3,4)24-21(25-20)18-10-8-17(9-11-18)15-23-14-13-22-16(23)2/h8-11,13-14H,6-7,12,15H2,1-5H3 |
| InChIKey | IIFOFZPMCBBVOG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|