About [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate
[3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate (PubChem CID 123200675) has the molecular formula C23H26FNO3
and a molecular weight of 383.46 g/mol. Its IUPAC name is [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate.
Molecular Properties
| Compound Name | [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate |
| PubChem CID | 123200675 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate |
| SMILES | NC(=O)c1cccc(-c2cccc(OC(=O)CCCC3CCCCC3)c2F)c1 |
| InChI | InChI=1S/C23H26FNO3/c24-22-19(17-10-5-11-18(15-17)23(25)27)12-6-13-20(22)28-21(26)14-4-9-16-7-2-1-3-8-16/h5-6,10-13,15-16H,1-4,7-9,14H2,(H2,25,27) |
| InChIKey | RKOQEIQEHLFLLV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate?
The IUPAC name of [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate (CID 123200675) is [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate.
What is the SMILES notation for [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate?
The canonical SMILES for [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate is NC(=O)c1cccc(-c2cccc(OC(=O)CCCC3CCCCC3)c2F)c1.
What is the InChIKey of [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate?
The InChIKey is RKOQEIQEHLFLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26FNO3/c24-22-19(17-10-5-11-18(15-17)23(25)27)12-6-13-20(22)28-21(26)14-4-9-16-7-2-1-3-8-16/h5-6,10-13,15-16H,1-4,7-9,14H2,(H2,25,27).
What are the key properties of [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate?
[3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate has a molecular weight of 383.46 g/mol, XLogP of 5.25, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-carbamoylphenyl)-2-fluorophenyl] 4-cyclohexylbutanoate is sourced from PubChem (CID 123200675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).