C21H23N3O2S — CID 123200724
2'-amino-7-methyl-2-pyridin-3-ylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol (PubChem CID 123200724) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2'-amino-7-methyl-2-pyridin-3-ylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol.
| Compound Name | 2'-amino-7-methyl-2-pyridin-3-ylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol |
|---|---|
| PubChem CID | 123200724 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2'-amino-7-methyl-2-pyridin-3-ylspiro[3,4,4a,9a-tetrahydro-1H-xanthene-9,4'-5H-1,3-thiazole]-2-ol |
| SMILES | Cc1ccc2c(c1)C1(CSC(N)=N1)C1CC(O)(c3cccnc3)CCC1O2 |
| InChI | InChI=1S/C21H23N3O2S/c1-13-4-5-17-15(9-13)21(12-27-19(22)24-21)16-10-20(25,7-6-18(16)26-17)14-3-2-8-23-11-14/h2-5,8-9,11,16,18,25H,6-7,10,12H2,1H3,(H2,22,24) |
| InChIKey | UFTDJLGOOJTAIM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |