About 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole
2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole (PubChem CID 123200941) has the molecular formula C19H14Cl2N2
and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole |
| PubChem CID | 123200941 |
| Molecular Formula | C19H14Cl2N2 |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole |
| SMILES | Clc1cc(Cl)cc(-c2ccnc(C3Cc4ccccc4N3)c2)c1 |
| InChI | InChI=1S/C19H14Cl2N2/c20-15-7-14(8-16(21)11-15)12-5-6-22-18(9-12)19-10-13-3-1-2-4-17(13)23-19/h1-9,11,19,23H,10H2 |
| InChIKey | XNIFYOMTZZMJGS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole?
The IUPAC name of 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole (CID 123200941) is 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole.
What is the SMILES notation for 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole?
The canonical SMILES for 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole is Clc1cc(Cl)cc(-c2ccnc(C3Cc4ccccc4N3)c2)c1.
What is the InChIKey of 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole?
The InChIKey is XNIFYOMTZZMJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N2/c20-15-7-14(8-16(21)11-15)12-5-6-22-18(9-12)19-10-13-3-1-2-4-17(13)23-19/h1-9,11,19,23H,10H2.
What are the key properties of 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole?
2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole has a molecular weight of 341.24 g/mol, XLogP of 5.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-dichlorophenyl)-2-pyridinyl]-2,3-dihydro-1H-indole is sourced from PubChem (CID 123200941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).