C31H49ClN8O7 — CID 123201127
3,5-diamino-6-chloro-N-[2-[(2-methylphenyl)methyl]-3-[[1-[3-(2,3,4,5,6-pentahydroxyhexylamino)propanoyl]piperidin-4-yl]methylamino]propyl]pyrazine-2-carboxamide (PubChem CID 123201127) has the molecular formula C31H49ClN8O7 and a molecular weight of 681.24 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[2-[(2-methylphenyl)methyl]-3-[[1-[3-(2,3,4,5,6-pentahydroxyhexylamino)propanoyl]piperidin-4-yl]methylamino]propyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[2-[(2-methylphenyl)methyl]-3-[[1-[3-(2,3,4,5,6-pentahydroxyhexylamino)propanoyl]piperidin-4-yl]methylamino]propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123201127 |
| Molecular Formula | C31H49ClN8O7 |
| Molecular Weight | 681.24 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[2-[(2-methylphenyl)methyl]-3-[[1-[3-(2,3,4,5,6-pentahydroxyhexylamino)propanoyl]piperidin-4-yl]methylamino]propyl]pyrazine-2-carboxamide |
| SMILES | Cc1ccccc1CC(CNCC1CCN(C(=O)CCNCC(O)C(O)C(O)C(O)CO)CC1)CNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C31H49ClN8O7/c1-18-4-2-3-5-21(18)12-20(15-37-31(47)25-29(33)39-30(34)28(32)38-25)14-36-13-19-7-10-40(11-8-19)24(44)6-9-35-16-22(42)26(45)27(46)23(43)17-41/h2-5,19-20,22-23,26-27,35-36,41-43,45-46H,6-17H2,1H3,(H,37,47)(H4,33,34,39) |
| InChIKey | KHUCEOAKSIQINH-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 252.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.24 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|