C23H20FN6O3S+ — CID 123201165
8-(1,1-dioxo-1,4-thiazinan-4-yl)-5-(6-fluoroquinolin-3-yl)-13-methylidene-2,3,7-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-one (PubChem CID 123201165) has the molecular formula C23H20FN6O3S+ and a molecular weight of 479.52 g/mol. Its IUPAC name is 8-(1,1-dioxo-1,4-thiazinan-4-yl)-5-(6-fluoroquinolin-3-yl)-13-methylidene-2,3,7-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-one.
| Compound Name | 8-(1,1-dioxo-1,4-thiazinan-4-yl)-5-(6-fluoroquinolin-3-yl)-13-methylidene-2,3,7-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-one |
|---|---|
| PubChem CID | 123201165 |
| Molecular Formula | C23H20FN6O3S+ |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | 8-(1,1-dioxo-1,4-thiazinan-4-yl)-5-(6-fluoroquinolin-3-yl)-13-methylidene-2,3,7-triaza-13-azoniatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-10-one |
| SMILES | C=[N+]1CCC(=O)c2c(N3CCS(=O)(=O)CC3)nc3c(-c4cnc5ccc(F)cc5c4)cnn3c21 |
| InChI | InChI=1S/C23H20FN6O3S/c1-28-5-4-19(31)20-22(29-6-8-34(32,33)9-7-29)27-21-17(13-26-30(21)23(20)28)15-10-14-11-16(24)2-3-18(14)25-12-15/h2-3,10-13H,1,4-9H2/q+1 |
| InChIKey | WKCHCBMGBMDNGM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|