C26H32N4O2 — CID 123201846
methyl 3-cyano-N-[1-[1-[2-(methylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate (PubChem CID 123201846) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is methyl 3-cyano-N-[1-[1-[2-(methylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate.
| Compound Name | methyl 3-cyano-N-[1-[1-[2-(methylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
|---|---|
| PubChem CID | 123201846 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | methyl 3-cyano-N-[1-[1-[2-(methylamino)ethylamino]-2,3-dihydro-1H-inden-4-yl]ethenyl]-4-propan-2-yloxybenzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2NCCNC |
| InChI | InChI=1S/C26H32N4O2/c1-17(2)32-25-12-9-19(15-20(25)16-27)26(31-5)30-18(3)21-7-6-8-23-22(21)10-11-24(23)29-14-13-28-4/h6-9,12,15,17,24,28-29H,3,10-11,13-14H2,1-2,4-5H3/b30-26- |
| InChIKey | CPEBVHGLALXAMV-BXVZCJGGSA-N |
| XLogP | 4.21 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|