About CID 123201872
CID 123201872 (PubChem CID 123201872) has the molecular formula C23H30N2O6S
and a molecular weight of 462.57 g/mol.
Molecular Properties
| Compound Name | CID 123201872 |
| PubChem CID | 123201872 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(O)CCC(C)(C)CCN2C(=O)OCc3ccccc32)ccc1O.N=S(=O)=O |
| InChI | InChI=1S/C23H29NO4.HNO2S/c1-16-14-17(8-9-20(16)25)21(26)10-11-23(2,3)12-13-24-19-7-5-4-6-18(19)15-28-22(24)27;1-4(2)3/h4-9,14,21,25-26H,10-13,15H2,1-3H3;1H |
| InChIKey | UXXWTKONEGCZOO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 123201872 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123201872?
The IUPAC name of CID 123201872 (CID 123201872) is not available.
What is the SMILES notation for CID 123201872?
The canonical SMILES for CID 123201872 is Cc1cc(C(O)CCC(C)(C)CCN2C(=O)OCc3ccccc32)ccc1O.N=S(=O)=O.
What is the InChIKey of CID 123201872?
The InChIKey is UXXWTKONEGCZOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29NO4.HNO2S/c1-16-14-17(8-9-20(16)25)21(26)10-11-23(2,3)12-13-24-19-7-5-4-6-18(19)15-28-22(24)27;1-4(2)3/h4-9,14,21,25-26H,10-13,15H2,1-3H3;1H.
What are the key properties of CID 123201872?
CID 123201872 has a molecular weight of 462.57 g/mol, XLogP of 4.72, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123201872 is sourced from PubChem (CID 123201872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).