C13H14BN3O2 — CID 123202243
1-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-2-pyridin-4-ylhydrazine (PubChem CID 123202243) has the molecular formula C13H14BN3O2 and a molecular weight of 255.09 g/mol. Its IUPAC name is 1-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-2-pyridin-4-ylhydrazine.
| Compound Name | 1-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-2-pyridin-4-ylhydrazine |
|---|---|
| PubChem CID | 123202243 |
| Molecular Formula | C13H14BN3O2 |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(1-hydroxy-3,4-dihydro-2,1-benzoxaborinin-7-yl)-2-pyridin-4-ylhydrazine |
| SMILES | OB1OCCc2ccc(NNc3ccncc3)cc21 |
| InChI | InChI=1S/C13H14BN3O2/c18-14-13-9-12(2-1-10(13)5-8-19-14)17-16-11-3-6-15-7-4-11/h1-4,6-7,9,17-18H,5,8H2,(H,15,16) |
| InChIKey | UKHXWUMMARQWLE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|