About methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate
methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate (PubChem CID 123202304) has the molecular formula C20H17F2NO3
and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate |
| PubChem CID | 123202304 |
| Molecular Formula | C20H17F2NO3 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1C(=O)C/C(=N\c2ccc(F)cc2F)CC1c1ccccc1 |
| InChI | InChI=1S/C20H17F2NO3/c1-26-20(25)19-15(12-5-3-2-4-6-12)10-14(11-18(19)24)23-17-8-7-13(21)9-16(17)22/h2-9,15,19H,10-11H2,1H3/b23-14- |
| InChIKey | NOGUKMRIMDBGPE-UCQKPKSFSA-N |
| XLogP | 3.97 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate?
The IUPAC name of methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate (CID 123202304) is methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate is COC(=O)C1C(=O)C/C(=N\c2ccc(F)cc2F)CC1c1ccccc1.
What is the InChIKey of methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate?
The InChIKey is NOGUKMRIMDBGPE-UCQKPKSFSA-N. The full InChI is InChI=1S/C20H17F2NO3/c1-26-20(25)19-15(12-5-3-2-4-6-12)10-14(11-18(19)24)23-17-8-7-13(21)9-16(17)22/h2-9,15,19H,10-11H2,1H3/b23-14-.
What are the key properties of methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate?
methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate has a molecular weight of 357.36 g/mol, XLogP of 3.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,4-difluorophenyl)imino-2-oxo-6-phenylcyclohexane-1-carboxylate is sourced from PubChem (CID 123202304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).