About 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine
6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine (PubChem CID 123202332) has the molecular formula C19H29ClN6O
and a molecular weight of 392.94 g/mol. Its IUPAC name is 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine |
| PubChem CID | 123202332 |
| Molecular Formula | C19H29ClN6O |
| Molecular Weight | 392.94 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine |
| SMILES | COC(CCc1cc2nc(N)c(N)nc2cc1CCCl)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H29ClN6O/c1-25-7-9-26(10-8-25)17(27-2)4-3-13-11-15-16(12-14(13)5-6-20)24-19(22)18(21)23-15/h11-12,17H,3-10H2,1-2H3,(H2,21,23)(H2,22,24) |
| InChIKey | CKKSGXXYJKMFRQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.94 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine?
The IUPAC name of 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine (CID 123202332) is 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine.
What is the SMILES notation for 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine?
The canonical SMILES for 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine is COC(CCc1cc2nc(N)c(N)nc2cc1CCCl)N1CCN(C)CC1.
What is the InChIKey of 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine?
The InChIKey is CKKSGXXYJKMFRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29ClN6O/c1-25-7-9-26(10-8-25)17(27-2)4-3-13-11-15-16(12-14(13)5-6-20)24-19(22)18(21)23-15/h11-12,17H,3-10H2,1-2H3,(H2,21,23)(H2,22,24).
What are the key properties of 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine?
6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine has a molecular weight of 392.94 g/mol, XLogP of 1.73, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-chloroethyl)-7-[3-methoxy-3-(4-methylpiperazin-1-yl)propyl]quinoxaline-2,3-diamine is sourced from PubChem (CID 123202332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).