C30H40N4O5 — CID 123202560
4-[2-[[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propyl]benzoic acid (PubChem CID 123202560) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is 4-[2-[[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propyl]benzoic acid.
| Compound Name | 4-[2-[[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propyl]benzoic acid |
|---|---|
| PubChem CID | 123202560 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 4-[2-[[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]amino]-3-oxo-3-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propyl]benzoic acid |
| SMILES | CNC(C)C(=O)NC(C(=O)NC(Cc1ccc(C(=O)O)cc1)C(=O)NC1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C30H40N4O5/c1-18(31-5)26(35)34-25(30(2,3)4)28(37)33-24(17-19-13-15-21(16-14-19)29(38)39)27(36)32-23-12-8-10-20-9-6-7-11-22(20)23/h6-7,9,11,13-16,18,23-25,31H,8,10,12,17H2,1-5H3,(H,32,36)(H,33,37)(H,34,35)(H,38,39) |
| InChIKey | MFMRTCQLHWRBRY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |