C20H30N4O2 — CID 123202656
(2E,6E)-2,7-diethyl-4,5-bis(methylimino)-N,N'-bis(prop-2-enyl)octa-2,6-dienediamide (PubChem CID 123202656) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is (2E,6E)-2,7-diethyl-4,5-bis(methylimino)-N,N'-bis(prop-2-enyl)octa-2,6-dienediamide.
| Compound Name | (2E,6E)-2,7-diethyl-4,5-bis(methylimino)-N,N'-bis(prop-2-enyl)octa-2,6-dienediamide |
|---|---|
| PubChem CID | 123202656 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (2E,6E)-2,7-diethyl-4,5-bis(methylimino)-N,N'-bis(prop-2-enyl)octa-2,6-dienediamide |
| SMILES | C=CCNC(=O)/C(=C/C(=NC)C(/C=C(\CC)C(=O)NCC=C)=N/C)CC |
| InChI | InChI=1S/C20H30N4O2/c1-7-11-23-19(25)15(9-3)13-17(21-5)18(22-6)14-16(10-4)20(26)24-12-8-2/h7-8,13-14H,1-2,9-12H2,3-6H3,(H,23,25)(H,24,26)/b15-13+,16-14+,21-17+,22-18+ |
| InChIKey | XLVPIWPGCTXMAK-PPJSMFRSSA-N |
| XLogP | 2.41 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|