C27H42O5 — CID 123202711
11-ethyl-8-hydroxy-3-(hydroxymethyl)-12-methoxy-9,13,15-trimethyl-18-propan-2-yl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one (PubChem CID 123202711) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is 11-ethyl-8-hydroxy-3-(hydroxymethyl)-12-methoxy-9,13,15-trimethyl-18-propan-2-yl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one.
| Compound Name | 11-ethyl-8-hydroxy-3-(hydroxymethyl)-12-methoxy-9,13,15-trimethyl-18-propan-2-yl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one |
|---|---|
| PubChem CID | 123202711 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 11-ethyl-8-hydroxy-3-(hydroxymethyl)-12-methoxy-9,13,15-trimethyl-18-propan-2-yl-1-oxacyclooctadeca-3,5,9,13,15-pentaen-2-one |
| SMILES | CCC1C=C(C)C(O)CC=CC=C(CO)C(=O)OC(C(C)C)CC=C(C)C=C(C)C1OC |
| InChI | InChI=1S/C27H42O5/c1-8-22-16-20(5)24(29)12-10-9-11-23(17-28)27(30)32-25(18(2)3)14-13-19(4)15-21(6)26(22)31-7/h9-11,13,15-16,18,22,24-26,28-29H,8,12,14,17H2,1-7H3 |
| InChIKey | HBUKQXRPTRTCBI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|