About N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine
N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine (PubChem CID 123202788) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine.
Molecular Properties
| Compound Name | N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine |
| PubChem CID | 123202788 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine |
| SMILES | CNCCCC=C(C)c1nc(C)no1 |
| InChI | InChI=1S/C10H17N3O/c1-8(6-4-5-7-11-3)10-12-9(2)13-14-10/h6,11H,4-5,7H2,1-3H3 |
| InChIKey | LNVQWGGIBNLKQF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine?
The IUPAC name of N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine (CID 123202788) is N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine.
What is the SMILES notation for N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine?
The canonical SMILES for N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine is CNCCCC=C(C)c1nc(C)no1.
What is the InChIKey of N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine?
The InChIKey is LNVQWGGIBNLKQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-8(6-4-5-7-11-3)10-12-9(2)13-14-10/h6,11H,4-5,7H2,1-3H3.
What are the key properties of N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine?
N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine has a molecular weight of 195.27 g/mol, XLogP of 1.78, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-5-(3-methyl-1,2,4-oxadiazol-5-yl)hex-4-en-1-amine is sourced from PubChem (CID 123202788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).