About (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine
(Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine (PubChem CID 123203347) has the molecular formula C13H20F3N
and a molecular weight of 247.30 g/mol. Its IUPAC name is (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine |
| PubChem CID | 123203347 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine |
| SMILES | CCC(/N=C(C)/C=C\C(C)C)=C(C)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-6-12(11(5)13(14,15)16)17-10(4)8-7-9(2)3/h7-9H,6H2,1-5H3/b8-7-,12-11?,17-10+ |
| InChIKey | BQHCUPTXUIXLTB-GJTIPTGRSA-N |
| XLogP | 4.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine?
The IUPAC name of (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine (CID 123203347) is (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine.
What is the SMILES notation for (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine?
The canonical SMILES for (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine is CCC(/N=C(C)/C=C\C(C)C)=C(C)C(F)(F)F.
What is the InChIKey of (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine?
The InChIKey is BQHCUPTXUIXLTB-GJTIPTGRSA-N. The full InChI is InChI=1S/C13H20F3N/c1-6-12(11(5)13(14,15)16)17-10(4)8-7-9(2)3/h7-9H,6H2,1-5H3/b8-7-,12-11?,17-10+.
What are the key properties of (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine?
(Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine has a molecular weight of 247.30 g/mol, XLogP of 4.91, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-methyl-N-(1,1,1-trifluoro-2-methylpent-2-en-3-yl)hex-3-en-2-imine is sourced from PubChem (CID 123203347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).