About (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane
(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123203622) has the molecular formula C8H14Si
and a molecular weight of 138.29 g/mol. Its IUPAC name is (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane.
Molecular Properties
| Compound Name | (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane |
| PubChem CID | 123203622 |
| Molecular Formula | C8H14Si |
| Molecular Weight | 138.29 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)=C([SiH3])C1 |
| InChI | InChI=1S/C8H14Si/c1-5-4-8(9)7(3)6(5)2/h4H2,1-3,9H3 |
| InChIKey | ZQBPBQUEUXXZCA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane?
The IUPAC name of (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane (CID 123203622) is (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane.
What is the SMILES notation for (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane?
The canonical SMILES for (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane is CC1=C(C)C(C)=C([SiH3])C1.
What is the InChIKey of (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane?
The InChIKey is ZQBPBQUEUXXZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Si/c1-5-4-8(9)7(3)6(5)2/h4H2,1-3,9H3.
What are the key properties of (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane?
(2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane has a molecular weight of 138.29 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,4-trimethylcyclopenta-1,3-dien-1-yl)silane is sourced from PubChem (CID 123203622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).