C19H21F3O2S — CID 123203695
1-hexylsulfonyl-4-phenyl-2-(trifluoromethyl)benzene (PubChem CID 123203695) has the molecular formula C19H21F3O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-hexylsulfonyl-4-phenyl-2-(trifluoromethyl)benzene.
| Compound Name | 1-hexylsulfonyl-4-phenyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 123203695 |
| Molecular Formula | C19H21F3O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 1-hexylsulfonyl-4-phenyl-2-(trifluoromethyl)benzene |
| SMILES | CCCCCCS(=O)(=O)c1ccc(-c2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H21F3O2S/c1-2-3-4-8-13-25(23,24)18-12-11-16(14-17(18)19(20,21)22)15-9-6-5-7-10-15/h5-7,9-12,14H,2-4,8,13H2,1H3 |
| InChIKey | RLZDZPGZDCLUPD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|