C19H25NO2 — CID 123203978
N-cyclobutyl-7-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)cyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 123203978) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is N-cyclobutyl-7-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)cyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | N-cyclobutyl-7-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)cyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 123203978 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-cyclobutyl-7-ethyl-4-(3-hydroxy-3-methylbut-1-ynyl)cyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | CCC1C=CC(C#CC(C)(C)O)=CC=C1C(=O)NC1CCC1 |
| InChI | InChI=1S/C19H25NO2/c1-4-15-10-8-14(12-13-19(2,3)22)9-11-17(15)18(21)20-16-6-5-7-16/h8-11,15-16,22H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | FDJYXFGEZYIFNH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|