C26H33ClN4O — CID 123204345
(Z)-4-[[1-[4-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)piperidin-1-yl]-2-methylbutylidene]amino]-2-methylidenebut-3-enenitrile (PubChem CID 123204345) has the molecular formula C26H33ClN4O and a molecular weight of 453.03 g/mol. Its IUPAC name is (Z)-4-[[1-[4-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)piperidin-1-yl]-2-methylbutylidene]amino]-2-methylidenebut-3-enenitrile.
| Compound Name | (Z)-4-[[1-[4-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)piperidin-1-yl]-2-methylbutylidene]amino]-2-methylidenebut-3-enenitrile |
|---|---|
| PubChem CID | 123204345 |
| Molecular Formula | C26H33ClN4O |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (Z)-4-[[1-[4-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)piperidin-1-yl]-2-methylbutylidene]amino]-2-methylidenebut-3-enenitrile |
| SMILES | C=C(C#N)/C=C\N=C(/C(C)CC)N1CCC(C(=O)N2CCCCc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C26H33ClN4O/c1-4-20(3)25(29-13-10-19(2)18-28)30-15-11-21(12-16-30)26(32)31-14-6-5-7-22-17-23(27)8-9-24(22)31/h8-10,13,17,20-21H,2,4-7,11-12,14-16H2,1,3H3/b13-10-,29-25+ |
| InChIKey | AXLJGZDUCWRWNW-OQPHZVIZSA-N |
| XLogP | 5.76 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|