C19H17BrN2O3S — CID 1232044
5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 1232044) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1232044 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-methyl-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=C2S/C(=N/c3ccc(C)cc3)N(C)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C19H17BrN2O3S/c1-11-4-6-13(7-5-11)21-19-22(2)18(24)16(26-19)10-12-8-14(20)17(23)15(9-12)25-3/h4-10,23H,1-3H3/b16-10?,21-19+ |
| InChIKey | NLQQNQDQZOBFMZ-KNQLEATESA-N |
| XLogP | 4.71 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|