C14H28N2 — CID 123204567
1-(5-ethyl-4,6-dimethyl-1,2,3,4,5,8-hexahydroazocin-8-yl)-N-methylethanamine (PubChem CID 123204567) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-(5-ethyl-4,6-dimethyl-1,2,3,4,5,8-hexahydroazocin-8-yl)-N-methylethanamine.
| Compound Name | 1-(5-ethyl-4,6-dimethyl-1,2,3,4,5,8-hexahydroazocin-8-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 123204567 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-(5-ethyl-4,6-dimethyl-1,2,3,4,5,8-hexahydroazocin-8-yl)-N-methylethanamine |
| SMILES | CCC1C(C)=CC(C(C)NC)NCCC1C |
| InChI | InChI=1S/C14H28N2/c1-6-13-10(2)7-8-16-14(9-11(13)3)12(4)15-5/h9-10,12-16H,6-8H2,1-5H3 |
| InChIKey | DTICNOXBFSLBNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|